methyl 2-chloro-4-fluorobenzoate
methyl 2-chloro-4-fluorobenzoate
CAS: 85953-29-3
Molecular Formula: C8H6ClFO2
methyl 2-chloro-4-fluorobenzoate - Names and Identifiers
| Name | methyl 2-chloro-4-fluorobenzoate |
| Synonyms | RARECHEM AL BF 0289 methyl 2-chloro-4-fluorob... methyl 2-chloro-4-fluorobenzoate Methyl 2-chloro-4-fluorobenzoate METHYL 2-CHLORO-4-FLUOROBENZOATE 2-CHLORO-4-FLUOROBENZOIC ACID METHYL ESTER METHYL 2-CHLORO-4-FLUOROBENZENECARBOXYLATE Benzoic acid, 2-chloro-4-fluoro-, Methyl ester |
| CAS | 85953-29-3 |
| InChI | InChI=1/C8H6ClFO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,1H3 |
methyl 2-chloro-4-fluorobenzoate - Physico-chemical Properties
| Molecular Formula | C8H6ClFO2 |
| Molar Mass | 188.58 |
| Density | 1.314±0.06 g/cm3(Predicted) |
| Melting Point | 103-105℃ |
| Boling Point | 110 °C |
| Flash Point | 103-105°C/15mm |
| Vapor Presure | 0.0918mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5150 to 1.5190 |
methyl 2-chloro-4-fluorobenzoate - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 1993 |
| Hazard Class | IRRITANT |
methyl 2-chloro-4-fluorobenzoate - Introduction
methyl 2-chloro-4-fluorobenzoate is an organic compound with the chemical formula C8H6ClFO2. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: methyl 2-chloroo-4-fluorobenzoate is a colorless to pale yellow liquid.
2. Solubility: Soluble in organic solvents such as ethanol, acetone and ether solvents.
Use:
1. methyl 2-chloro-4-fluorobenzoate is commonly used as a drug and pesticide intermediate for the synthesis of various organic compounds.
2. It can also be used as a reagent and catalyst in organic synthesis reactions.
Preparation Method:
methyl 2-chloro-4-fluorobenzoate is usually prepared by the following steps:
1. First, p-chlorobenzoic acid and p-fluorobenzoic acid are condensed under alkaline conditions.
2. Then, esterification with methyl formate is carried out under acidic conditions to generate methyl 2-choro-4-fluorobenzoate.
Safety Information:
1. methyl 2-chroo-4-fluorobenzoate is irritating to the human body at room temperature, and contact with skin and eyes should be avoided.
2. in use or operation, should follow the chemical safety guidelines, wear appropriate personal protective equipment.
3. In case of accidental inhalation or contact, immediately keep away from the source, ventilate the place and seek medical help.
4. When storing, keep it in a closed container, away from fire and flammable materials.
Nature:
1. Appearance: methyl 2-chloroo-4-fluorobenzoate is a colorless to pale yellow liquid.
2. Solubility: Soluble in organic solvents such as ethanol, acetone and ether solvents.
Use:
1. methyl 2-chloro-4-fluorobenzoate is commonly used as a drug and pesticide intermediate for the synthesis of various organic compounds.
2. It can also be used as a reagent and catalyst in organic synthesis reactions.
Preparation Method:
methyl 2-chloro-4-fluorobenzoate is usually prepared by the following steps:
1. First, p-chlorobenzoic acid and p-fluorobenzoic acid are condensed under alkaline conditions.
2. Then, esterification with methyl formate is carried out under acidic conditions to generate methyl 2-choro-4-fluorobenzoate.
Safety Information:
1. methyl 2-chroo-4-fluorobenzoate is irritating to the human body at room temperature, and contact with skin and eyes should be avoided.
2. in use or operation, should follow the chemical safety guidelines, wear appropriate personal protective equipment.
3. In case of accidental inhalation or contact, immediately keep away from the source, ventilate the place and seek medical help.
4. When storing, keep it in a closed container, away from fire and flammable materials.
Last Update：2024-04-09 21:01:54
